About 4-(7-methyl-2,3-dihydro-1H-indolizin-4-ium-6-yl)phenol
4-(7-methyl-2,3-dihydro-1H-indolizin-4-ium-6-yl)phenol (PubChem CID 11346031) has the molecular formula C15H16NO+
and a molecular weight of 226.30 g/mol. Its IUPAC name is 4-(7-methyl-2,3-dihydro-1H-indolizin-4-ium-6-yl)phenol.
Molecular Properties
| Compound Name | 4-(7-methyl-2,3-dihydro-1H-indolizin-4-ium-6-yl)phenol |
| PubChem CID | 11346031 |
| Molecular Formula | C15H16NO+ |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 4-(7-methyl-2,3-dihydro-1H-indolizin-4-ium-6-yl)phenol |
| SMILES | Cc1cc2[n+](cc1-c1ccc(O)cc1)CCC2 |
| InChI | InChI=1S/C15H15NO/c1-11-9-13-3-2-8-16(13)10-15(11)12-4-6-14(17)7-5-12/h4-7,9-10H,2-3,8H2,1H3/p+1 |
| InChIKey | PTGFJAXMSHAWHR-UHFFFAOYSA-O |
| XLogP | 2.60 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(7-methyl-2,3-dihydro-1H-indolizin-4-ium-6-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-methyl-2,3-dihydro-1H-indolizin-4-ium-6-yl)phenol?
The IUPAC name of 4-(7-methyl-2,3-dihydro-1H-indolizin-4-ium-6-yl)phenol (CID 11346031) is 4-(7-methyl-2,3-dihydro-1H-indolizin-4-ium-6-yl)phenol.
What is the SMILES notation for 4-(7-methyl-2,3-dihydro-1H-indolizin-4-ium-6-yl)phenol?
The canonical SMILES for 4-(7-methyl-2,3-dihydro-1H-indolizin-4-ium-6-yl)phenol is Cc1cc2[n+](cc1-c1ccc(O)cc1)CCC2.
What is the InChIKey of 4-(7-methyl-2,3-dihydro-1H-indolizin-4-ium-6-yl)phenol?
The InChIKey is PTGFJAXMSHAWHR-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H15NO/c1-11-9-13-3-2-8-16(13)10-15(11)12-4-6-14(17)7-5-12/h4-7,9-10H,2-3,8H2,1H3/p+1.
What are the key properties of 4-(7-methyl-2,3-dihydro-1H-indolizin-4-ium-6-yl)phenol?
4-(7-methyl-2,3-dihydro-1H-indolizin-4-ium-6-yl)phenol has a molecular weight of 226.30 g/mol, XLogP of 2.60, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-methyl-2,3-dihydro-1H-indolizin-4-ium-6-yl)phenol is sourced from PubChem (CID 11346031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).