C12H11N3O2 — CID 113460317
3-methoxy-4-(1,3-oxazol-5-ylmethylamino)benzonitrile (PubChem CID 113460317) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 3-methoxy-4-(1,3-oxazol-5-ylmethylamino)benzonitrile.
| Compound Name | 3-methoxy-4-(1,3-oxazol-5-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 113460317 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-methoxy-4-(1,3-oxazol-5-ylmethylamino)benzonitrile |
| SMILES | COc1cc(C#N)ccc1NCc1cnco1 |
| InChI | InChI=1S/C12H11N3O2/c1-16-12-4-9(5-13)2-3-11(12)15-7-10-6-14-8-17-10/h2-4,6,8,15H,7H2,1H3 |
| InChIKey | BQIJKCZFJMGJKJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |