C16H22O3 — CID 11346051
2-methoxy-3,5-dimethyl-6-[(2E,4E)-4-methylhepta-2,4-dien-2-yl]pyran-4-one (PubChem CID 11346051) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-methoxy-3,5-dimethyl-6-[(2E,4E)-4-methylhepta-2,4-dien-2-yl]pyran-4-one.
| Compound Name | 2-methoxy-3,5-dimethyl-6-[(2E,4E)-4-methylhepta-2,4-dien-2-yl]pyran-4-one |
|---|---|
| PubChem CID | 11346051 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-methoxy-3,5-dimethyl-6-[(2E,4E)-4-methylhepta-2,4-dien-2-yl]pyran-4-one |
| SMILES | CC/C=C(C)/C=C(\C)c1oc(OC)c(C)c(=O)c1C |
| InChI | InChI=1S/C16H22O3/c1-7-8-10(2)9-11(3)15-12(4)14(17)13(5)16(18-6)19-15/h8-9H,7H2,1-6H3/b10-8+,11-9+ |
| InChIKey | LPDSVBCPAZAWDN-GFULKKFKSA-N |
| XLogP | 4.02 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|