C13H29N3O — CID 113461930
N',N'-dimethyl-N-(1-morpholin-3-ylpropan-2-yl)butane-1,4-diamine (PubChem CID 113461930) has the molecular formula C13H29N3O and a molecular weight of 243.39 g/mol. Its IUPAC name is N',N'-dimethyl-N-(1-morpholin-3-ylpropan-2-yl)butane-1,4-diamine.
| Compound Name | N',N'-dimethyl-N-(1-morpholin-3-ylpropan-2-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 113461930 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | N',N'-dimethyl-N-(1-morpholin-3-ylpropan-2-yl)butane-1,4-diamine |
| SMILES | CC(CC1COCCN1)NCCCCN(C)C |
| InChI | InChI=1S/C13H29N3O/c1-12(10-13-11-17-9-7-15-13)14-6-4-5-8-16(2)3/h12-15H,4-11H2,1-3H3 |
| InChIKey | YHFJMSOWDYGHIP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|