C13H26FNO2S — CID 113462317
2-(5-ethylsulfonyl-2-fluoro-2-methylpentyl)piperidine (PubChem CID 113462317) has the molecular formula C13H26FNO2S and a molecular weight of 279.42 g/mol. Its IUPAC name is 2-(5-ethylsulfonyl-2-fluoro-2-methylpentyl)piperidine.
| Compound Name | 2-(5-ethylsulfonyl-2-fluoro-2-methylpentyl)piperidine |
|---|---|
| PubChem CID | 113462317 |
| Molecular Formula | C13H26FNO2S |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 2-(5-ethylsulfonyl-2-fluoro-2-methylpentyl)piperidine |
| SMILES | CCS(=O)(=O)CCCC(C)(F)CC1CCCCN1 |
| InChI | InChI=1S/C13H26FNO2S/c1-3-18(16,17)10-6-8-13(2,14)11-12-7-4-5-9-15-12/h12,15H,3-11H2,1-2H3 |
| InChIKey | RQLJNCSRWYUIHJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |