About bicyclo[2.2.1]hepta-2,5-diene;dichloropalladium
bicyclo[2.2.1]hepta-2,5-diene;dichloropalladium (PubChem CID 11346242) has the molecular formula C7H8Cl2Pd
and a molecular weight of 269.47 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-2,5-diene;dichloropalladium.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hepta-2,5-diene;dichloropalladium |
| PubChem CID | 11346242 |
| Molecular Formula | C7H8Cl2Pd |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 267.90 |
| IUPAC Name | bicyclo[2.2.1]hepta-2,5-diene;dichloropalladium |
| SMILES | C1=CC2C=CC1C2.Cl[Pd]Cl |
| InChI | InChI=1S/C7H8.2ClH.Pd/c1-2-7-4-3-6(1)5-7;;;/h1-4,6-7H,5H2;2*1H;/q;;;+2/p-2 |
| InChIKey | BNCRZJHZZCMDNP-UHFFFAOYSA-L |
| XLogP | 3.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hepta-2,5-diene;dichloropalladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hepta-2,5-diene;dichloropalladium?
The IUPAC name of bicyclo[2.2.1]hepta-2,5-diene;dichloropalladium (CID 11346242) is bicyclo[2.2.1]hepta-2,5-diene;dichloropalladium.
What is the SMILES notation for bicyclo[2.2.1]hepta-2,5-diene;dichloropalladium?
The canonical SMILES for bicyclo[2.2.1]hepta-2,5-diene;dichloropalladium is C1=CC2C=CC1C2.Cl[Pd]Cl.
What is the InChIKey of bicyclo[2.2.1]hepta-2,5-diene;dichloropalladium?
The InChIKey is BNCRZJHZZCMDNP-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H8.2ClH.Pd/c1-2-7-4-3-6(1)5-7;;;/h1-4,6-7H,5H2;2*1H;/q;;;+2/p-2.
What are the key properties of bicyclo[2.2.1]hepta-2,5-diene;dichloropalladium?
bicyclo[2.2.1]hepta-2,5-diene;dichloropalladium has a molecular weight of 269.47 g/mol, XLogP of 3.12, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hepta-2,5-diene;dichloropalladium is sourced from PubChem (CID 11346242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).