C18H22O2 — CID 11346272
4-butoxy-2-phenyl-4,5,6,7-tetrahydro-1-benzofuran (PubChem CID 11346272) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 4-butoxy-2-phenyl-4,5,6,7-tetrahydro-1-benzofuran.
| Compound Name | 4-butoxy-2-phenyl-4,5,6,7-tetrahydro-1-benzofuran |
|---|---|
| PubChem CID | 11346272 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 4-butoxy-2-phenyl-4,5,6,7-tetrahydro-1-benzofuran |
| SMILES | CCCCOC1CCCc2oc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C18H22O2/c1-2-3-12-19-16-10-7-11-17-15(16)13-18(20-17)14-8-5-4-6-9-14/h4-6,8-9,13,16H,2-3,7,10-12H2,1H3 |
| InChIKey | ZIYWABYFWULIEP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|