C10H16F3N3O — CID 113463023
2-methyl-N-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide (PubChem CID 113463023) has the molecular formula C10H16F3N3O and a molecular weight of 251.25 g/mol. Its IUPAC name is 2-methyl-N-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide.
| Compound Name | 2-methyl-N-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 113463023 |
| Molecular Formula | C10H16F3N3O |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-methyl-N-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide |
| SMILES | CC1CC2CNCC2N1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H16F3N3O/c1-6-2-7-3-14-4-8(7)16(6)9(17)15-5-10(11,12)13/h6-8,14H,2-5H2,1H3,(H,15,17) |
| InChIKey | AIJNNPXUNXJXFD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |