C11H18F3N3O — CID 113463040
4-ethyl-N-(2,2,2-trifluoroethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 113463040) has the molecular formula C11H18F3N3O and a molecular weight of 265.28 g/mol. Its IUPAC name is 4-ethyl-N-(2,2,2-trifluoroethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | 4-ethyl-N-(2,2,2-trifluoroethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 113463040 |
| Molecular Formula | C11H18F3N3O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 4-ethyl-N-(2,2,2-trifluoroethyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | CCC1C2CNCC2CN1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H18F3N3O/c1-2-9-8-4-15-3-7(8)5-17(9)10(18)16-6-11(12,13)14/h7-9,15H,2-6H2,1H3,(H,16,18) |
| InChIKey | VMTJDXPHBRJEAH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |