C9H17F3N4O — CID 113463071
1-(3-carbamimidoylpentan-3-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 113463071) has the molecular formula C9H17F3N4O and a molecular weight of 254.26 g/mol. Its IUPAC name is 1-(3-carbamimidoylpentan-3-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(3-carbamimidoylpentan-3-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 113463071 |
| Molecular Formula | C9H17F3N4O |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1-(3-carbamimidoylpentan-3-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | [H]/N=C(\N)C(CC)(CC)NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N4O/c1-3-8(4-2,6(13)14)16-7(17)15-5-9(10,11)12/h3-5H2,1-2H3,(H3,13,14)(H2,15,16,17) |
| InChIKey | AFFSVJSDJWNIEV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|