C13H25F2NO — CID 113463359
3-[(2-tert-butylcyclohexyl)amino]-2,2-difluoropropan-1-ol (PubChem CID 113463359) has the molecular formula C13H25F2NO and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-[(2-tert-butylcyclohexyl)amino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(2-tert-butylcyclohexyl)amino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 113463359 |
| Molecular Formula | C13H25F2NO |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 3-[(2-tert-butylcyclohexyl)amino]-2,2-difluoropropan-1-ol |
| SMILES | CC(C)(C)C1CCCCC1NCC(F)(F)CO |
| InChI | InChI=1S/C13H25F2NO/c1-12(2,3)10-6-4-5-7-11(10)16-8-13(14,15)9-17/h10-11,16-17H,4-9H2,1-3H3 |
| InChIKey | ZNMFCKPJTIRBSS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |