About 2-[3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,2-oxazol-5-yl]ethanol
2-[3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,2-oxazol-5-yl]ethanol (PubChem CID 113463537) has the molecular formula C11H15N3O3
and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-[3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,2-oxazol-5-yl]ethanol.
Molecular Properties
| Compound Name | 2-[3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,2-oxazol-5-yl]ethanol |
| PubChem CID | 113463537 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 2-[3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,2-oxazol-5-yl]ethanol |
| SMILES | COc1c(-c2cc(CCO)on2)c(C)nn1C |
| InChI | InChI=1S/C11H15N3O3/c1-7-10(11(16-3)14(2)12-7)9-6-8(4-5-15)17-13-9/h6,15H,4-5H2,1-3H3 |
| InChIKey | FFEIYKVSXYHBEZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,2-oxazol-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,2-oxazol-5-yl]ethanol?
The IUPAC name of 2-[3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,2-oxazol-5-yl]ethanol (CID 113463537) is 2-[3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,2-oxazol-5-yl]ethanol.
What is the SMILES notation for 2-[3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,2-oxazol-5-yl]ethanol?
The canonical SMILES for 2-[3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,2-oxazol-5-yl]ethanol is COc1c(-c2cc(CCO)on2)c(C)nn1C.
What is the InChIKey of 2-[3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,2-oxazol-5-yl]ethanol?
The InChIKey is FFEIYKVSXYHBEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O3/c1-7-10(11(16-3)14(2)12-7)9-6-8(4-5-15)17-13-9/h6,15H,4-5H2,1-3H3.
What are the key properties of 2-[3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,2-oxazol-5-yl]ethanol?
2-[3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,2-oxazol-5-yl]ethanol has a molecular weight of 237.26 g/mol, XLogP of 0.93, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-1,2-oxazol-5-yl]ethanol is sourced from PubChem (CID 113463537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).