C13H17NO4S — CID 113463674
2-[4-[(2-methylcyclopropyl)methylsulfamoyl]phenyl]acetic acid (PubChem CID 113463674) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-[4-[(2-methylcyclopropyl)methylsulfamoyl]phenyl]acetic acid.
| Compound Name | 2-[4-[(2-methylcyclopropyl)methylsulfamoyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 113463674 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-[4-[(2-methylcyclopropyl)methylsulfamoyl]phenyl]acetic acid |
| SMILES | CC1CC1CNS(=O)(=O)c1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C13H17NO4S/c1-9-6-11(9)8-14-19(17,18)12-4-2-10(3-5-12)7-13(15)16/h2-5,9,11,14H,6-8H2,1H3,(H,15,16) |
| InChIKey | SPVHYFSMSPCANX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |