About 1-(3,4-dichlorophenyl)-1,2-dihydronaphthalene
1-(3,4-dichlorophenyl)-1,2-dihydronaphthalene (PubChem CID 11346391) has the molecular formula C16H12Cl2
and a molecular weight of 275.18 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 1-(3,4-dichlorophenyl)-1,2-dihydronaphthalene |
| PubChem CID | 11346391 |
| Molecular Formula | C16H12Cl2 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-1,2-dihydronaphthalene |
| SMILES | Clc1ccc(C2CC=Cc3ccccc32)cc1Cl |
| InChI | InChI=1S/C16H12Cl2/c17-15-9-8-12(10-16(15)18)14-7-3-5-11-4-1-2-6-13(11)14/h1-6,8-10,14H,7H2 |
| InChIKey | ZLSPQUYRIXMVNQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(3,4-dichlorophenyl)-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dichlorophenyl)-1,2-dihydronaphthalene?
The IUPAC name of 1-(3,4-dichlorophenyl)-1,2-dihydronaphthalene (CID 11346391) is 1-(3,4-dichlorophenyl)-1,2-dihydronaphthalene.
What is the SMILES notation for 1-(3,4-dichlorophenyl)-1,2-dihydronaphthalene?
The canonical SMILES for 1-(3,4-dichlorophenyl)-1,2-dihydronaphthalene is Clc1ccc(C2CC=Cc3ccccc32)cc1Cl.
What is the InChIKey of 1-(3,4-dichlorophenyl)-1,2-dihydronaphthalene?
The InChIKey is ZLSPQUYRIXMVNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl2/c17-15-9-8-12(10-16(15)18)14-7-3-5-11-4-1-2-6-13(11)14/h1-6,8-10,14H,7H2.
What are the key properties of 1-(3,4-dichlorophenyl)-1,2-dihydronaphthalene?
1-(3,4-dichlorophenyl)-1,2-dihydronaphthalene has a molecular weight of 275.18 g/mol, XLogP of 5.54, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dichlorophenyl)-1,2-dihydronaphthalene is sourced from PubChem (CID 11346391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).