C13H28N2O2 — CID 113464190
1-[4-(2-methoxyethoxy)butyl]-3-methyl-1,4-diazepane (PubChem CID 113464190) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-[4-(2-methoxyethoxy)butyl]-3-methyl-1,4-diazepane.
| Compound Name | 1-[4-(2-methoxyethoxy)butyl]-3-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 113464190 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1-[4-(2-methoxyethoxy)butyl]-3-methyl-1,4-diazepane |
| SMILES | COCCOCCCCN1CCCNC(C)C1 |
| InChI | InChI=1S/C13H28N2O2/c1-13-12-15(8-5-6-14-13)7-3-4-9-17-11-10-16-2/h13-14H,3-12H2,1-2H3 |
| InChIKey | CVUBTYCLTLASIW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|