C13H28O4Si — CID 11346442
(3S)-3-hydroxy-4-tri(propan-2-yl)silyloxybutanoic acid (PubChem CID 11346442) has the molecular formula C13H28O4Si and a molecular weight of 276.45 g/mol. Its IUPAC name is (3S)-3-hydroxy-4-tri(propan-2-yl)silyloxybutanoic acid.
| Compound Name | (3S)-3-hydroxy-4-tri(propan-2-yl)silyloxybutanoic acid |
|---|---|
| PubChem CID | 11346442 |
| Molecular Formula | C13H28O4Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (3S)-3-hydroxy-4-tri(propan-2-yl)silyloxybutanoic acid |
| SMILES | CC(C)[Si](OC[C@@H](O)CC(=O)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C13H28O4Si/c1-9(2)18(10(3)4,11(5)6)17-8-12(14)7-13(15)16/h9-12,14H,7-8H2,1-6H3,(H,15,16)/t12-/m0/s1 |
| InChIKey | RZRQKVJJIDHNLG-LBPRGKRZSA-N |
| XLogP | 3.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|