C11H19N3O2S — CID 113464431
3-[(6-ethoxypyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol (PubChem CID 113464431) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 3-[(6-ethoxypyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol.
| Compound Name | 3-[(6-ethoxypyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 113464431 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-[(6-ethoxypyrimidin-4-yl)amino]-2-methylsulfanylbutan-1-ol |
| SMILES | CCOc1cc(NC(C)C(CO)SC)ncn1 |
| InChI | InChI=1S/C11H19N3O2S/c1-4-16-11-5-10(12-7-13-11)14-8(2)9(6-15)17-3/h5,7-9,15H,4,6H2,1-3H3,(H,12,13,14) |
| InChIKey | XDYPVCWWXZIKDH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |