C17H27NO2 — CID 11346462
(1R,3S,4R,5S,9S,12R)-4-ethenyl-5,8,8,12-tetramethyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-6-one (PubChem CID 11346462) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is (1R,3S,4R,5S,9S,12R)-4-ethenyl-5,8,8,12-tetramethyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-6-one.
| Compound Name | (1R,3S,4R,5S,9S,12R)-4-ethenyl-5,8,8,12-tetramethyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-6-one |
|---|---|
| PubChem CID | 11346462 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | (1R,3S,4R,5S,9S,12R)-4-ethenyl-5,8,8,12-tetramethyl-2-oxa-7-azatricyclo[7.4.0.03,7]tridecan-6-one |
| SMILES | C=C[C@@H]1[C@H](C)C(=O)N2[C@H]1O[C@@H]1C[C@H](C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C17H27NO2/c1-6-12-11(3)15(19)18-16(12)20-14-9-10(2)7-8-13(14)17(18,4)5/h6,10-14,16H,1,7-9H2,2-5H3/t10-,11+,12-,13-,14-,16+/m1/s1 |
| InChIKey | GGULUWVIROXCIV-RZTQCUEVSA-N |
| XLogP | 3.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|