C5Cl4F4 — CID 11346464
1,2,3,4-tetrachloro-3,4,5,5-tetrafluorocyclopentene (PubChem CID 11346464) has the molecular formula C5Cl4F4 and a molecular weight of 277.86 g/mol. Its IUPAC name is 1,2,3,4-tetrachloro-3,4,5,5-tetrafluorocyclopentene.
| Compound Name | 1,2,3,4-tetrachloro-3,4,5,5-tetrafluorocyclopentene |
|---|---|
| PubChem CID | 11346464 |
| Molecular Formula | C5Cl4F4 |
| Molecular Weight | 277.86 g/mol |
| Exact Mass | 275.87 |
| IUPAC Name | 1,2,3,4-tetrachloro-3,4,5,5-tetrafluorocyclopentene |
| SMILES | FC1(F)C(Cl)=C(Cl)C(F)(Cl)C1(F)Cl |
| InChI | InChI=1S/C5Cl4F4/c6-1-2(7)4(11,12)5(9,13)3(1,8)10 |
| InChIKey | OTBDGDBQMYBTLY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.86 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|