C13H17N3O — CID 113464676
3-(but-2-ynylamino)-N'-hydroxy-2-phenylpropanimidamide (PubChem CID 113464676) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 3-(but-2-ynylamino)-N'-hydroxy-2-phenylpropanimidamide.
| Compound Name | 3-(but-2-ynylamino)-N'-hydroxy-2-phenylpropanimidamide |
|---|---|
| PubChem CID | 113464676 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 3-(but-2-ynylamino)-N'-hydroxy-2-phenylpropanimidamide |
| SMILES | CC#CCNCC(/C(N)=N/O)c1ccccc1 |
| InChI | InChI=1S/C13H17N3O/c1-2-3-9-15-10-12(13(14)16-17)11-7-5-4-6-8-11/h4-8,12,15,17H,9-10H2,1H3,(H2,14,16) |
| InChIKey | YKDLNVBRSUCRED-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|