C15H30N2 — CID 113465530
1-(aminomethyl)-N-but-3-enyl-4-propan-2-ylcycloheptan-1-amine (PubChem CID 113465530) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 1-(aminomethyl)-N-but-3-enyl-4-propan-2-ylcycloheptan-1-amine.
| Compound Name | 1-(aminomethyl)-N-but-3-enyl-4-propan-2-ylcycloheptan-1-amine |
|---|---|
| PubChem CID | 113465530 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 1-(aminomethyl)-N-but-3-enyl-4-propan-2-ylcycloheptan-1-amine |
| SMILES | C=CCCNC1(CN)CCCC(C(C)C)CC1 |
| InChI | InChI=1S/C15H30N2/c1-4-5-11-17-15(12-16)9-6-7-14(8-10-15)13(2)3/h4,13-14,17H,1,5-12,16H2,2-3H3 |
| InChIKey | NNGCMDWUELLGNV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|