C13H16N2O3 — CID 113465862
4-(but-3-enylcarbamoylamino)-3-methylbenzoic acid (PubChem CID 113465862) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 4-(but-3-enylcarbamoylamino)-3-methylbenzoic acid.
| Compound Name | 4-(but-3-enylcarbamoylamino)-3-methylbenzoic acid |
|---|---|
| PubChem CID | 113465862 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 4-(but-3-enylcarbamoylamino)-3-methylbenzoic acid |
| SMILES | C=CCCNC(=O)Nc1ccc(C(=O)O)cc1C |
| InChI | InChI=1S/C13H16N2O3/c1-3-4-7-14-13(18)15-11-6-5-10(12(16)17)8-9(11)2/h3,5-6,8H,1,4,7H2,2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | YBQHASQHKZKMJZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|