C12H19N3OS — CID 113465915
4-tert-butyl-N-[(E)-pent-3-enyl]thiadiazole-5-carboxamide (PubChem CID 113465915) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 4-tert-butyl-N-[(E)-pent-3-enyl]thiadiazole-5-carboxamide.
| Compound Name | 4-tert-butyl-N-[(E)-pent-3-enyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 113465915 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-tert-butyl-N-[(E)-pent-3-enyl]thiadiazole-5-carboxamide |
| SMILES | C/C=C/CCNC(=O)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C12H19N3OS/c1-5-6-7-8-13-11(16)9-10(12(2,3)4)14-15-17-9/h5-6H,7-8H2,1-4H3,(H,13,16)/b6-5+ |
| InChIKey | AGBLJDNVXSTKLN-AATRIKPKSA-N |
| XLogP | 2.53 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|