C12H18N2O3S — CID 113466272
4-amino-2-methoxy-N-pent-4-en-2-ylbenzenesulfonamide (PubChem CID 113466272) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 4-amino-2-methoxy-N-pent-4-en-2-ylbenzenesulfonamide.
| Compound Name | 4-amino-2-methoxy-N-pent-4-en-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 113466272 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-amino-2-methoxy-N-pent-4-en-2-ylbenzenesulfonamide |
| SMILES | C=CCC(C)NS(=O)(=O)c1ccc(N)cc1OC |
| InChI | InChI=1S/C12H18N2O3S/c1-4-5-9(2)14-18(15,16)12-7-6-10(13)8-11(12)17-3/h4,6-9,14H,1,5,13H2,2-3H3 |
| InChIKey | UPBLRVLUDPASNK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|