C15H20N2O — CID 113466553
N-pent-4-en-2-yl-1,2,3,4-tetrahydroisoquinoline-4-carboxamide (PubChem CID 113466553) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is N-pent-4-en-2-yl-1,2,3,4-tetrahydroisoquinoline-4-carboxamide.
| Compound Name | N-pent-4-en-2-yl-1,2,3,4-tetrahydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 113466553 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N-pent-4-en-2-yl-1,2,3,4-tetrahydroisoquinoline-4-carboxamide |
| SMILES | C=CCC(C)NC(=O)C1CNCc2ccccc21 |
| InChI | InChI=1S/C15H20N2O/c1-3-6-11(2)17-15(18)14-10-16-9-12-7-4-5-8-13(12)14/h3-5,7-8,11,14,16H,1,6,9-10H2,2H3,(H,17,18) |
| InChIKey | QOKNSHDSJSPAJN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|