C13H24N2O2S — CID 113466958
3,3-diethyl-1-(2-methylsulfanylpropyl)-1,4-diazepane-2,5-dione (PubChem CID 113466958) has the molecular formula C13H24N2O2S and a molecular weight of 272.41 g/mol. Its IUPAC name is 3,3-diethyl-1-(2-methylsulfanylpropyl)-1,4-diazepane-2,5-dione.
| Compound Name | 3,3-diethyl-1-(2-methylsulfanylpropyl)-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 113466958 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 3,3-diethyl-1-(2-methylsulfanylpropyl)-1,4-diazepane-2,5-dione |
| SMILES | CCC1(CC)NC(=O)CCN(CC(C)SC)C1=O |
| InChI | InChI=1S/C13H24N2O2S/c1-5-13(6-2)12(17)15(9-10(3)18-4)8-7-11(16)14-13/h10H,5-9H2,1-4H3,(H,14,16) |
| InChIKey | YDGSIRXQXZVKBQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |