C13H19NO2S — CID 113467284
4-ethylsulfonyl-N-(3-methylcyclobutyl)aniline (PubChem CID 113467284) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 4-ethylsulfonyl-N-(3-methylcyclobutyl)aniline.
| Compound Name | 4-ethylsulfonyl-N-(3-methylcyclobutyl)aniline |
|---|---|
| PubChem CID | 113467284 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-ethylsulfonyl-N-(3-methylcyclobutyl)aniline |
| SMILES | CCS(=O)(=O)c1ccc(NC2CC(C)C2)cc1 |
| InChI | InChI=1S/C13H19NO2S/c1-3-17(15,16)13-6-4-11(5-7-13)14-12-8-10(2)9-12/h4-7,10,12,14H,3,8-9H2,1-2H3 |
| InChIKey | QXWCJJFAJFTNCD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |