C9H20N2O4S2 — CID 113467768
2-[2-hydroxyethyl(2-methoxyethyl)sulfamoyl]butanethioamide (PubChem CID 113467768) has the molecular formula C9H20N2O4S2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(2-methoxyethyl)sulfamoyl]butanethioamide.
| Compound Name | 2-[2-hydroxyethyl(2-methoxyethyl)sulfamoyl]butanethioamide |
|---|---|
| PubChem CID | 113467768 |
| Molecular Formula | C9H20N2O4S2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-[2-hydroxyethyl(2-methoxyethyl)sulfamoyl]butanethioamide |
| SMILES | CCC(C(N)=S)S(=O)(=O)N(CCO)CCOC |
| InChI | InChI=1S/C9H20N2O4S2/c1-3-8(9(10)16)17(13,14)11(4-6-12)5-7-15-2/h8,12H,3-7H2,1-2H3,(H2,10,16) |
| InChIKey | ZZFUNFJCFFAMGR-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|