C16H19NO4 — CID 11346785
(1S,6R)-1-benzamido-6-hydroxy-3,4-dimethylcyclohex-3-ene-1-carboxylic acid (PubChem CID 11346785) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (1S,6R)-1-benzamido-6-hydroxy-3,4-dimethylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-1-benzamido-6-hydroxy-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 11346785 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (1S,6R)-1-benzamido-6-hydroxy-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=C(C)C[C@@](NC(=O)c2ccccc2)(C(=O)O)[C@H](O)C1 |
| InChI | InChI=1S/C16H19NO4/c1-10-8-13(18)16(15(20)21,9-11(10)2)17-14(19)12-6-4-3-5-7-12/h3-7,13,18H,8-9H2,1-2H3,(H,17,19)(H,20,21)/t13-,16+/m1/s1 |
| InChIKey | JHCMZMUWOAYJHC-CJNGLKHVSA-N |
| XLogP | 1.73 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|