C13H19BrClNO2 — CID 113468132
N-[(2-bromo-5-methoxyphenyl)methyl]-N-(2-chloroethyl)-2-methoxyethanamine (PubChem CID 113468132) has the molecular formula C13H19BrClNO2 and a molecular weight of 336.66 g/mol. Its IUPAC name is N-[(2-bromo-5-methoxyphenyl)methyl]-N-(2-chloroethyl)-2-methoxyethanamine.
| Compound Name | N-[(2-bromo-5-methoxyphenyl)methyl]-N-(2-chloroethyl)-2-methoxyethanamine |
|---|---|
| PubChem CID | 113468132 |
| Molecular Formula | C13H19BrClNO2 |
| Molecular Weight | 336.66 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | N-[(2-bromo-5-methoxyphenyl)methyl]-N-(2-chloroethyl)-2-methoxyethanamine |
| SMILES | COCCN(CCCl)Cc1cc(OC)ccc1Br |
| InChI | InChI=1S/C13H19BrClNO2/c1-17-8-7-16(6-5-15)10-11-9-12(18-2)3-4-13(11)14/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | OURYABUXQQNMSW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.66 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|