C14H21BrN2O — CID 113469921
[1-(aminomethyl)-4-methylcyclohexyl]-(5-bromo-3-pyridinyl)methanol (PubChem CID 113469921) has the molecular formula C14H21BrN2O and a molecular weight of 313.24 g/mol. Its IUPAC name is [1-(aminomethyl)-4-methylcyclohexyl]-(5-bromo-3-pyridinyl)methanol.
| Compound Name | [1-(aminomethyl)-4-methylcyclohexyl]-(5-bromo-3-pyridinyl)methanol |
|---|---|
| PubChem CID | 113469921 |
| Molecular Formula | C14H21BrN2O |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [1-(aminomethyl)-4-methylcyclohexyl]-(5-bromo-3-pyridinyl)methanol |
| SMILES | CC1CCC(CN)(C(O)c2cncc(Br)c2)CC1 |
| InChI | InChI=1S/C14H21BrN2O/c1-10-2-4-14(9-16,5-3-10)13(18)11-6-12(15)8-17-7-11/h6-8,10,13,18H,2-5,9,16H2,1H3 |
| InChIKey | UERHQDISODRWNC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |