C14H17NO4 — CID 11347096
(1S,3R,4R)-1-amino-4-(4-methylphenyl)cyclopentane-1,3-dicarboxylic acid (PubChem CID 11347096) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is (1S,3R,4R)-1-amino-4-(4-methylphenyl)cyclopentane-1,3-dicarboxylic acid.
| Compound Name | (1S,3R,4R)-1-amino-4-(4-methylphenyl)cyclopentane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 11347096 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (1S,3R,4R)-1-amino-4-(4-methylphenyl)cyclopentane-1,3-dicarboxylic acid |
| SMILES | Cc1ccc([C@@H]2C[C@@](N)(C(=O)O)C[C@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C14H17NO4/c1-8-2-4-9(5-3-8)10-6-14(15,13(18)19)7-11(10)12(16)17/h2-5,10-11H,6-7,15H2,1H3,(H,16,17)(H,18,19)/t10-,11+,14-/m0/s1 |
| InChIKey | DPQMDRSEYLKIOV-WDMOLILDSA-N |
| XLogP | 1.36 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |