C18H24O2Si — CID 11347131
(3aS,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3a,4-dihydro-3H-cyclopenta[a]inden-2-one (PubChem CID 11347131) has the molecular formula C18H24O2Si and a molecular weight of 300.47 g/mol. Its IUPAC name is (3aS,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3a,4-dihydro-3H-cyclopenta[a]inden-2-one.
| Compound Name | (3aS,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3a,4-dihydro-3H-cyclopenta[a]inden-2-one |
|---|---|
| PubChem CID | 11347131 |
| Molecular Formula | C18H24O2Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (3aS,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3a,4-dihydro-3H-cyclopenta[a]inden-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1c2ccccc2C2=CC(=O)C[C@@H]21 |
| InChI | InChI=1S/C18H24O2Si/c1-18(2,3)21(4,5)20-17-14-9-7-6-8-13(14)15-10-12(19)11-16(15)17/h6-10,16-17H,11H2,1-5H3/t16-,17-/m0/s1 |
| InChIKey | QNGLKAISGLVSCO-IRXDYDNUSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|