About methyl 3-[(4,4,4-trifluorobutan-2-ylamino)methyl]furan-2-carboxylate
methyl 3-[(4,4,4-trifluorobutan-2-ylamino)methyl]furan-2-carboxylate (PubChem CID 113472103) has the molecular formula C11H14F3NO3
and a molecular weight of 265.23 g/mol. Its IUPAC name is methyl 3-[(4,4,4-trifluorobutan-2-ylamino)methyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[(4,4,4-trifluorobutan-2-ylamino)methyl]furan-2-carboxylate |
| PubChem CID | 113472103 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | methyl 3-[(4,4,4-trifluorobutan-2-ylamino)methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1CNC(C)CC(F)(F)F |
| InChI | InChI=1S/C11H14F3NO3/c1-7(5-11(12,13)14)15-6-8-3-4-18-9(8)10(16)17-2/h3-4,7,15H,5-6H2,1-2H3 |
| InChIKey | PDOXIAABEYQGPP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[(4,4,4-trifluorobutan-2-ylamino)methyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(4,4,4-trifluorobutan-2-ylamino)methyl]furan-2-carboxylate?
The IUPAC name of methyl 3-[(4,4,4-trifluorobutan-2-ylamino)methyl]furan-2-carboxylate (CID 113472103) is methyl 3-[(4,4,4-trifluorobutan-2-ylamino)methyl]furan-2-carboxylate.
What is the SMILES notation for methyl 3-[(4,4,4-trifluorobutan-2-ylamino)methyl]furan-2-carboxylate?
The canonical SMILES for methyl 3-[(4,4,4-trifluorobutan-2-ylamino)methyl]furan-2-carboxylate is COC(=O)c1occc1CNC(C)CC(F)(F)F.
What is the InChIKey of methyl 3-[(4,4,4-trifluorobutan-2-ylamino)methyl]furan-2-carboxylate?
The InChIKey is PDOXIAABEYQGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3NO3/c1-7(5-11(12,13)14)15-6-8-3-4-18-9(8)10(16)17-2/h3-4,7,15H,5-6H2,1-2H3.
What are the key properties of methyl 3-[(4,4,4-trifluorobutan-2-ylamino)methyl]furan-2-carboxylate?
methyl 3-[(4,4,4-trifluorobutan-2-ylamino)methyl]furan-2-carboxylate has a molecular weight of 265.23 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(4,4,4-trifluorobutan-2-ylamino)methyl]furan-2-carboxylate is sourced from PubChem (CID 113472103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).