C11H19N3O2S — CID 113473562
5-amino-1-ethyl-3-(3-ethylsulfanylpropyl)pyrimidine-2,4-dione (PubChem CID 113473562) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 5-amino-1-ethyl-3-(3-ethylsulfanylpropyl)pyrimidine-2,4-dione.
| Compound Name | 5-amino-1-ethyl-3-(3-ethylsulfanylpropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 113473562 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 5-amino-1-ethyl-3-(3-ethylsulfanylpropyl)pyrimidine-2,4-dione |
| SMILES | CCSCCCn1c(=O)c(N)cn(CC)c1=O |
| InChI | InChI=1S/C11H19N3O2S/c1-3-13-8-9(12)10(15)14(11(13)16)6-5-7-17-4-2/h8H,3-7,12H2,1-2H3 |
| InChIKey | YFPCNPSHAPYDLU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|