C13H21N3OS — CID 113473702
2-[(4-aminophenyl)methyl-(2-ethylsulfanylethyl)amino]acetamide (PubChem CID 113473702) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methyl-(2-ethylsulfanylethyl)amino]acetamide.
| Compound Name | 2-[(4-aminophenyl)methyl-(2-ethylsulfanylethyl)amino]acetamide |
|---|---|
| PubChem CID | 113473702 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-[(4-aminophenyl)methyl-(2-ethylsulfanylethyl)amino]acetamide |
| SMILES | CCSCCN(CC(N)=O)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C13H21N3OS/c1-2-18-8-7-16(10-13(15)17)9-11-3-5-12(14)6-4-11/h3-6H,2,7-10,14H2,1H3,(H2,15,17) |
| InChIKey | HMTBCRRDQBMOHV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|