C13H18O4S2 — CID 113473862
4-ethyl-3-(3-methylsulfanylpropylsulfonyl)benzoic acid (PubChem CID 113473862) has the molecular formula C13H18O4S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-ethyl-3-(3-methylsulfanylpropylsulfonyl)benzoic acid.
| Compound Name | 4-ethyl-3-(3-methylsulfanylpropylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 113473862 |
| Molecular Formula | C13H18O4S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-ethyl-3-(3-methylsulfanylpropylsulfonyl)benzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)CCCSC |
| InChI | InChI=1S/C13H18O4S2/c1-3-10-5-6-11(13(14)15)9-12(10)19(16,17)8-4-7-18-2/h5-6,9H,3-4,7-8H2,1-2H3,(H,14,15) |
| InChIKey | MJACDGZEJAUQDK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|