C17H27NO4 — CID 11347402
2-O-tert-butyl 1-O-ethyl 1-methyl-4,5,6,7-tetrahydro-3H-isoindole-1,2-dicarboxylate (PubChem CID 11347402) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O-ethyl 1-methyl-4,5,6,7-tetrahydro-3H-isoindole-1,2-dicarboxylate.
| Compound Name | 2-O-tert-butyl 1-O-ethyl 1-methyl-4,5,6,7-tetrahydro-3H-isoindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11347402 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-O-tert-butyl 1-O-ethyl 1-methyl-4,5,6,7-tetrahydro-3H-isoindole-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C)C2=C(CCCC2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27NO4/c1-6-21-14(19)17(5)13-10-8-7-9-12(13)11-18(17)15(20)22-16(2,3)4/h6-11H2,1-5H3 |
| InChIKey | FWWCUBCYCGIIEM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|