C13H24N2OS — CID 113474138
1-(3-ethylsulfanylpropyl)-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-one (PubChem CID 113474138) has the molecular formula C13H24N2OS and a molecular weight of 256.41 g/mol. Its IUPAC name is 1-(3-ethylsulfanylpropyl)-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-one.
| Compound Name | 1-(3-ethylsulfanylpropyl)-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 113474138 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 1-(3-ethylsulfanylpropyl)-3,4,4a,5,6,7,8,8a-octahydro-1,6-naphthyridin-2-one |
| SMILES | CCSCCCN1C(=O)CCC2CNCCC21 |
| InChI | InChI=1S/C13H24N2OS/c1-2-17-9-3-8-15-12-6-7-14-10-11(12)4-5-13(15)16/h11-12,14H,2-10H2,1H3 |
| InChIKey | CMGFFDKVFKWLGP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|