About 6-ethyl-3,6-dimethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione
6-ethyl-3,6-dimethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione (PubChem CID 113474617) has the molecular formula C12H22N2O2S
and a molecular weight of 258.39 g/mol. Its IUPAC name is 6-ethyl-3,6-dimethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 6-ethyl-3,6-dimethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione |
| PubChem CID | 113474617 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 6-ethyl-3,6-dimethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione |
| SMILES | CCC1(C)C(=O)NC(C)C(=O)N1CCCSC |
| InChI | InChI=1S/C12H22N2O2S/c1-5-12(3)11(16)13-9(2)10(15)14(12)7-6-8-17-4/h9H,5-8H2,1-4H3,(H,13,16) |
| InChIKey | VMFOTYQXXVLCKU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-3,6-dimethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3,6-dimethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione?
The IUPAC name of 6-ethyl-3,6-dimethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione (CID 113474617) is 6-ethyl-3,6-dimethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione.
What is the SMILES notation for 6-ethyl-3,6-dimethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione?
The canonical SMILES for 6-ethyl-3,6-dimethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione is CCC1(C)C(=O)NC(C)C(=O)N1CCCSC.
What is the InChIKey of 6-ethyl-3,6-dimethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione?
The InChIKey is VMFOTYQXXVLCKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2S/c1-5-12(3)11(16)13-9(2)10(15)14(12)7-6-8-17-4/h9H,5-8H2,1-4H3,(H,13,16).
What are the key properties of 6-ethyl-3,6-dimethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione?
6-ethyl-3,6-dimethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione has a molecular weight of 258.39 g/mol, XLogP of 1.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3,6-dimethyl-1-(3-methylsulfanylpropyl)piperazine-2,5-dione is sourced from PubChem (CID 113474617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).