About ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate
ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate (PubChem CID 11347513) has the molecular formula C15H23NO6
and a molecular weight of 313.35 g/mol. Its IUPAC name is ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate.
Molecular Properties
| Compound Name | ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate |
| PubChem CID | 11347513 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate |
| SMILES | CCOC(=O)c1cc(OCCOC)c(OCCOC)cc1N |
| InChI | InChI=1S/C15H23NO6/c1-4-20-15(17)11-9-13(21-7-5-18-2)14(10-12(11)16)22-8-6-19-3/h9-10H,4-8,16H2,1-3H3 |
| InChIKey | YZOWMIHUDJVXBH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate?
The IUPAC name of ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate (CID 11347513) is ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate.
What is the SMILES notation for ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate?
The canonical SMILES for ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate is CCOC(=O)c1cc(OCCOC)c(OCCOC)cc1N.
What is the InChIKey of ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate?
The InChIKey is YZOWMIHUDJVXBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO6/c1-4-20-15(17)11-9-13(21-7-5-18-2)14(10-12(11)16)22-8-6-19-3/h9-10H,4-8,16H2,1-3H3.
What are the key properties of ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate?
ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate has a molecular weight of 313.35 g/mol, XLogP of 1.50, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate is sourced from PubChem (CID 11347513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).