C12H18ClN3O2 — CID 113475743
3-chloro-N'-hydroxy-4-[(1-hydroxy-2-methylpropan-2-yl)-methylamino]benzenecarboximidamide (PubChem CID 113475743) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is 3-chloro-N'-hydroxy-4-[(1-hydroxy-2-methylpropan-2-yl)-methylamino]benzenecarboximidamide.
| Compound Name | 3-chloro-N'-hydroxy-4-[(1-hydroxy-2-methylpropan-2-yl)-methylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 113475743 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-chloro-N'-hydroxy-4-[(1-hydroxy-2-methylpropan-2-yl)-methylamino]benzenecarboximidamide |
| SMILES | CN(c1ccc(/C(N)=N/O)cc1Cl)C(C)(C)CO |
| InChI | InChI=1S/C12H18ClN3O2/c1-12(2,7-17)16(3)10-5-4-8(6-9(10)13)11(14)15-18/h4-6,17-18H,7H2,1-3H3,(H2,14,15) |
| InChIKey | CDYPDAXLAPYTAE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|