About 1-bromo-N-[(4-tert-butylphenyl)methyl]-N,2-dimethylpropan-2-amine
1-bromo-N-[(4-tert-butylphenyl)methyl]-N,2-dimethylpropan-2-amine (PubChem CID 113476438) has the molecular formula C16H26BrN
and a molecular weight of 312.29 g/mol. Its IUPAC name is 1-bromo-N-[(4-tert-butylphenyl)methyl]-N,2-dimethylpropan-2-amine.
Molecular Properties
| Compound Name | 1-bromo-N-[(4-tert-butylphenyl)methyl]-N,2-dimethylpropan-2-amine |
| PubChem CID | 113476438 |
| Molecular Formula | C16H26BrN |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-bromo-N-[(4-tert-butylphenyl)methyl]-N,2-dimethylpropan-2-amine |
| SMILES | CN(Cc1ccc(C(C)(C)C)cc1)C(C)(C)CBr |
| InChI | InChI=1S/C16H26BrN/c1-15(2,3)14-9-7-13(8-10-14)11-18(6)16(4,5)12-17/h7-10H,11-12H2,1-6H3 |
| InChIKey | WFTNIDOGIKUSII-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-N-[(4-tert-butylphenyl)methyl]-N,2-dimethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-N-[(4-tert-butylphenyl)methyl]-N,2-dimethylpropan-2-amine?
The IUPAC name of 1-bromo-N-[(4-tert-butylphenyl)methyl]-N,2-dimethylpropan-2-amine (CID 113476438) is 1-bromo-N-[(4-tert-butylphenyl)methyl]-N,2-dimethylpropan-2-amine.
What is the SMILES notation for 1-bromo-N-[(4-tert-butylphenyl)methyl]-N,2-dimethylpropan-2-amine?
The canonical SMILES for 1-bromo-N-[(4-tert-butylphenyl)methyl]-N,2-dimethylpropan-2-amine is CN(Cc1ccc(C(C)(C)C)cc1)C(C)(C)CBr.
What is the InChIKey of 1-bromo-N-[(4-tert-butylphenyl)methyl]-N,2-dimethylpropan-2-amine?
The InChIKey is WFTNIDOGIKUSII-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26BrN/c1-15(2,3)14-9-7-13(8-10-14)11-18(6)16(4,5)12-17/h7-10H,11-12H2,1-6H3.
What are the key properties of 1-bromo-N-[(4-tert-butylphenyl)methyl]-N,2-dimethylpropan-2-amine?
1-bromo-N-[(4-tert-butylphenyl)methyl]-N,2-dimethylpropan-2-amine has a molecular weight of 312.29 g/mol, XLogP of 4.59, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-N-[(4-tert-butylphenyl)methyl]-N,2-dimethylpropan-2-amine is sourced from PubChem (CID 113476438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).