C20H18N2O2 — CID 11347703
6,9-dimethoxy-4-methyl-1-phenylpyrrolo[3,2-c]quinoline (PubChem CID 11347703) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 6,9-dimethoxy-4-methyl-1-phenylpyrrolo[3,2-c]quinoline.
| Compound Name | 6,9-dimethoxy-4-methyl-1-phenylpyrrolo[3,2-c]quinoline |
|---|---|
| PubChem CID | 11347703 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 6,9-dimethoxy-4-methyl-1-phenylpyrrolo[3,2-c]quinoline |
| SMILES | COc1ccc(OC)c2c1nc(C)c1ccn(-c3ccccc3)c12 |
| InChI | InChI=1S/C20H18N2O2/c1-13-15-11-12-22(14-7-5-4-6-8-14)20(15)18-16(23-2)9-10-17(24-3)19(18)21-13/h4-12H,1-3H3 |
| InChIKey | FTYRMCBPROPKKY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |