C14H17BrN2O — CID 113477360
N-(3-bromophenyl)-2-(hex-5-yn-3-ylamino)acetamide (PubChem CID 113477360) has the molecular formula C14H17BrN2O and a molecular weight of 309.21 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-(hex-5-yn-3-ylamino)acetamide.
| Compound Name | N-(3-bromophenyl)-2-(hex-5-yn-3-ylamino)acetamide |
|---|---|
| PubChem CID | 113477360 |
| Molecular Formula | C14H17BrN2O |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | N-(3-bromophenyl)-2-(hex-5-yn-3-ylamino)acetamide |
| SMILES | C#CCC(CC)NCC(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C14H17BrN2O/c1-3-6-12(4-2)16-10-14(18)17-13-8-5-7-11(15)9-13/h1,5,7-9,12,16H,4,6,10H2,2H3,(H,17,18) |
| InChIKey | JRTHKFISFUALQT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|