C15H18N2O — CID 113477489
N-pent-4-yn-2-yl-1,2,3,4-tetrahydroisoquinoline-5-carboxamide (PubChem CID 113477489) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is N-pent-4-yn-2-yl-1,2,3,4-tetrahydroisoquinoline-5-carboxamide.
| Compound Name | N-pent-4-yn-2-yl-1,2,3,4-tetrahydroisoquinoline-5-carboxamide |
|---|---|
| PubChem CID | 113477489 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-pent-4-yn-2-yl-1,2,3,4-tetrahydroisoquinoline-5-carboxamide |
| SMILES | C#CCC(C)NC(=O)c1cccc2c1CCNC2 |
| InChI | InChI=1S/C15H18N2O/c1-3-5-11(2)17-15(18)14-7-4-6-12-10-16-9-8-13(12)14/h1,4,6-7,11,16H,5,8-10H2,2H3,(H,17,18) |
| InChIKey | YOMXRADVPPKZNX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|