C21H22O3 — CID 11347839
7-[2-(4-ethoxyphenyl)ethynyl]-3,3-dimethyl-2,4-dihydro-1,5-benzodioxepine (PubChem CID 11347839) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is 7-[2-(4-ethoxyphenyl)ethynyl]-3,3-dimethyl-2,4-dihydro-1,5-benzodioxepine.
| Compound Name | 7-[2-(4-ethoxyphenyl)ethynyl]-3,3-dimethyl-2,4-dihydro-1,5-benzodioxepine |
|---|---|
| PubChem CID | 11347839 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 7-[2-(4-ethoxyphenyl)ethynyl]-3,3-dimethyl-2,4-dihydro-1,5-benzodioxepine |
| SMILES | CCOc1ccc(C#Cc2ccc3c(c2)OCC(C)(C)CO3)cc1 |
| InChI | InChI=1S/C21H22O3/c1-4-22-18-10-7-16(8-11-18)5-6-17-9-12-19-20(13-17)24-15-21(2,3)14-23-19/h7-13H,4,14-15H2,1-3H3 |
| InChIKey | HGWSQHMOLHEOJS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|