C20H34O3 — CID 11347851
(2S,4aR,5S,8aR)-1,1,4a-trimethyl-5-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol (PubChem CID 11347851) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (2S,4aR,5S,8aR)-1,1,4a-trimethyl-5-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol.
| Compound Name | (2S,4aR,5S,8aR)-1,1,4a-trimethyl-5-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 11347851 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (2S,4aR,5S,8aR)-1,1,4a-trimethyl-5-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalen-2-ol |
| SMILES | C=C1CC[C@H]2C(C)(C)[C@@H](O)CC[C@]2(C)[C@H]1CCC1(C)OCCO1 |
| InChI | InChI=1S/C20H34O3/c1-14-6-7-16-18(2,3)17(21)9-10-19(16,4)15(14)8-11-20(5)22-12-13-23-20/h15-17,21H,1,6-13H2,2-5H3/t15-,16-,17-,19+/m0/s1 |
| InChIKey | OXYJTASOPIRJPO-LSTDLKDCSA-N |
| XLogP | 4.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|