C13H18INOS2 — CID 113479751
2-iodo-N-(1-oxothian-4-yl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 113479751) has the molecular formula C13H18INOS2 and a molecular weight of 395.33 g/mol. Its IUPAC name is 2-iodo-N-(1-oxothian-4-yl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-iodo-N-(1-oxothian-4-yl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 113479751 |
| Molecular Formula | C13H18INOS2 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | 2-iodo-N-(1-oxothian-4-yl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | O=S1CCC(NC2CCCc3sc(I)cc32)CC1 |
| InChI | InChI=1S/C13H18INOS2/c14-13-8-10-11(2-1-3-12(10)17-13)15-9-4-6-18(16)7-5-9/h8-9,11,15H,1-7H2 |
| InChIKey | VAJVMGCRQMINKG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|