About 4-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiane 1-oxide
4-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiane 1-oxide (PubChem CID 113480270) has the molecular formula C12H17ClN4OS
and a molecular weight of 300.82 g/mol. Its IUPAC name is 4-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiane 1-oxide.
Molecular Properties
| Compound Name | 4-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiane 1-oxide |
| PubChem CID | 113480270 |
| Molecular Formula | C12H17ClN4OS |
| Molecular Weight | 300.82 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiane 1-oxide |
| SMILES | Cc1nn(C)c2c1nc(CCl)n2C1CCS(=O)CC1 |
| InChI | InChI=1S/C12H17ClN4OS/c1-8-11-12(16(2)15-8)17(10(7-13)14-11)9-3-5-19(18)6-4-9/h9H,3-7H2,1-2H3 |
| InChIKey | XJFHAEXQHFEFAM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.82 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiane 1-oxide?
The IUPAC name of 4-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiane 1-oxide (CID 113480270) is 4-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiane 1-oxide.
What is the SMILES notation for 4-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiane 1-oxide?
The canonical SMILES for 4-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiane 1-oxide is Cc1nn(C)c2c1nc(CCl)n2C1CCS(=O)CC1.
What is the InChIKey of 4-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiane 1-oxide?
The InChIKey is XJFHAEXQHFEFAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClN4OS/c1-8-11-12(16(2)15-8)17(10(7-13)14-11)9-3-5-19(18)6-4-9/h9H,3-7H2,1-2H3.
What are the key properties of 4-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiane 1-oxide?
4-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiane 1-oxide has a molecular weight of 300.82 g/mol, XLogP of 1.90, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(chloromethyl)-1,3-dimethylimidazo[4,5-d]pyrazol-6-yl]thiane 1-oxide is sourced from PubChem (CID 113480270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).